C13H22O2 — CID 88858169
(3S,4S,5E,7E,9E)-4,6-dimethylundeca-5,7,9-triene-1,3-diol (PubChem CID 88858169) has the molecular formula C13H22O2 and a molecular weight of 210.32 g/mol. Its IUPAC name is (3S,4S,5E,7E,9E)-4,6-dimethylundeca-5,7,9-triene-1,3-diol.
| Compound Name | (3S,4S,5E,7E,9E)-4,6-dimethylundeca-5,7,9-triene-1,3-diol |
|---|---|
| PubChem CID | 88858169 |
| Molecular Formula | C13H22O2 |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.16 |
| IUPAC Name | (3S,4S,5E,7E,9E)-4,6-dimethylundeca-5,7,9-triene-1,3-diol |
| SMILES | C/C=C/C=C/C(C)=C/[C@H](C)[C@@H](O)CCO |
| InChI | InChI=1S/C13H22O2/c1-4-5-6-7-11(2)10-12(3)13(15)8-9-14/h4-7,10,12-15H,8-9H2,1-3H3/b5-4+,7-6+,11-10+/t12-,13-/m0/s1 |
| InChIKey | NKTADILQMFCKLC-DNBGMSNMSA-N |
| XLogP | 2.44 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|