C15H17Cl2NO — CID 88858314
2,4-dichloro-5-[(2R,4R,5R)-5-ethyl-4-methyloxolan-2-yl]-5H-cyclopenta[b]pyridine (PubChem CID 88858314) has the molecular formula C15H17Cl2NO and a molecular weight of 298.21 g/mol. Its IUPAC name is 2,4-dichloro-5-[(2R,4R,5R)-5-ethyl-4-methyloxolan-2-yl]-5H-cyclopenta[b]pyridine.
| Compound Name | 2,4-dichloro-5-[(2R,4R,5R)-5-ethyl-4-methyloxolan-2-yl]-5H-cyclopenta[b]pyridine |
|---|---|
| PubChem CID | 88858314 |
| Molecular Formula | C15H17Cl2NO |
| Molecular Weight | 298.21 g/mol |
| Exact Mass | 297.07 |
| IUPAC Name | 2,4-dichloro-5-[(2R,4R,5R)-5-ethyl-4-methyloxolan-2-yl]-5H-cyclopenta[b]pyridine |
| SMILES | CC[C@H]1O[C@@H](C2C=Cc3nc(Cl)cc(Cl)c32)C[C@H]1C |
| InChI | InChI=1S/C15H17Cl2NO/c1-3-12-8(2)6-13(19-12)9-4-5-11-15(9)10(16)7-14(17)18-11/h4-5,7-9,12-13H,3,6H2,1-2H3/t8-,9?,12-,13-/m1/s1 |
| InChIKey | YKNVOOQFMKZXSK-HVMURFQRSA-N |
| XLogP | 4.70 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.21 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|