C26H37F17O5S — CID 88858319
2-[3-[difluoro-(3,3,4,7,7,8,8-heptafluoro-2,2,5,5,6,6,9,9-octamethyldecan-4-yl)oxymethyl]-3,4,4,4-tetrafluoro-2-methylbutan-2-yl]oxy-1,1,2,2-tetrafluoroethanesulfonic acid (PubChem CID 88858319) has the molecular formula C26H37F17O5S and a molecular weight of 784.61 g/mol. Its IUPAC name is 2-[3-[difluoro-(3,3,4,7,7,8,8-heptafluoro-2,2,5,5,6,6,9,9-octamethyldecan-4-yl)oxymethyl]-3,4,4,4-tetrafluoro-2-methylbutan-2-yl]oxy-1,1,2,2-tetrafluoroethanesulfonic acid.
| Compound Name | 2-[3-[difluoro-(3,3,4,7,7,8,8-heptafluoro-2,2,5,5,6,6,9,9-octamethyldecan-4-yl)oxymethyl]-3,4,4,4-tetrafluoro-2-methylbutan-2-yl]oxy-1,1,2,2-tetrafluoroethanesulfonic acid |
|---|---|
| PubChem CID | 88858319 |
| Molecular Formula | C26H37F17O5S |
| Molecular Weight | 784.61 g/mol |
| Exact Mass | 784.21 |
| IUPAC Name | 2-[3-[difluoro-(3,3,4,7,7,8,8-heptafluoro-2,2,5,5,6,6,9,9-octamethyldecan-4-yl)oxymethyl]-3,4,4,4-tetrafluoro-2-methylbutan-2-yl]oxy-1,1,2,2-tetrafluoroethanesulfonic acid |
| SMILES | CC(C)(C)C(F)(F)C(F)(F)C(C)(C)C(C)(C)C(F)(OC(F)(F)C(F)(C(F)(F)F)C(C)(C)OC(F)(F)C(F)(F)S(=O)(=O)O)C(F)(F)C(C)(C)C |
| InChI | InChI=1S/C26H37F17O5S/c1-13(2,3)19(28,29)21(32,33)15(7,8)16(9,10)22(34,20(30,31)14(4,5)6)48-24(38,39)18(27,23(35,36)37)17(11,12)47-25(40,41)26(42,43)49(44,45)46/h1-12H3,(H,44,45,46) |
| InChIKey | XNPUFTCPPKIJPN-UHFFFAOYSA-N |
| XLogP | 10.45 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 784.61 |
| LogP ≤ 5 | 10.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|