About CID 88858734
CID 88858734 (PubChem CID 88858734) has the molecular formula C10H20BN
and a molecular weight of 165.09 g/mol.
Molecular Properties
| Compound Name | CID 88858734 |
| PubChem CID | 88858734 |
| Molecular Formula | C10H20BN |
| Molecular Weight | 165.09 g/mol |
| Exact Mass | 165.17 |
| IUPAC Name | — |
| SMILES | [B]C1CCCCCCC(N)CC1 |
| InChI | InChI=1S/C10H20BN/c11-9-5-3-1-2-4-6-10(12)8-7-9/h9-10H,1-8,12H2 |
| InChIKey | CRDRUFAZLQAOJV-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.09 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 88858734 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 88858734?
The IUPAC name of CID 88858734 (CID 88858734) is not available.
What is the SMILES notation for CID 88858734?
The canonical SMILES for CID 88858734 is [B]C1CCCCCCC(N)CC1.
What is the InChIKey of CID 88858734?
The InChIKey is CRDRUFAZLQAOJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20BN/c11-9-5-3-1-2-4-6-10(12)8-7-9/h9-10H,1-8,12H2.
What are the key properties of CID 88858734?
CID 88858734 has a molecular weight of 165.09 g/mol, XLogP of 2.41, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 88858734 is sourced from PubChem (CID 88858734), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).