C21H27N3O — CID 88858749
(5aR,9aR)-2-cyclohexyl-8-isocyano-6,6,9a-trimethyl-5,5a-dihydro-4H-benzo[g]indazol-7-one (PubChem CID 88858749) has the molecular formula C21H27N3O and a molecular weight of 337.47 g/mol. Its IUPAC name is (5aR,9aR)-2-cyclohexyl-8-isocyano-6,6,9a-trimethyl-5,5a-dihydro-4H-benzo[g]indazol-7-one.
| Compound Name | (5aR,9aR)-2-cyclohexyl-8-isocyano-6,6,9a-trimethyl-5,5a-dihydro-4H-benzo[g]indazol-7-one |
|---|---|
| PubChem CID | 88858749 |
| Molecular Formula | C21H27N3O |
| Molecular Weight | 337.47 g/mol |
| Exact Mass | 337.22 |
| IUPAC Name | (5aR,9aR)-2-cyclohexyl-8-isocyano-6,6,9a-trimethyl-5,5a-dihydro-4H-benzo[g]indazol-7-one |
| SMILES | [C-]#[N+]C1=C[C@]2(C)c3nn(C4CCCCC4)cc3CC[C@H]2C(C)(C)C1=O |
| InChI | InChI=1S/C21H27N3O/c1-20(2)17-11-10-14-13-24(15-8-6-5-7-9-15)23-18(14)21(17,3)12-16(22-4)19(20)25/h12-13,15,17H,5-11H2,1-3H3/t17-,21-/m0/s1 |
| InChIKey | TVGJTZXEIJKZHN-UWJYYQICSA-N |
| XLogP | 4.62 |
| TPSA | 39.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.47 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|