C26H25N3O — CID 88858786
(5aR,9aR)-8-isocyano-2,6,6,9a-tetramethyl-3-naphthalen-1-yl-5,5a-dihydro-4H-benzo[g]indazol-7-one (PubChem CID 88858786) has the molecular formula C26H25N3O and a molecular weight of 395.51 g/mol. Its IUPAC name is (5aR,9aR)-8-isocyano-2,6,6,9a-tetramethyl-3-naphthalen-1-yl-5,5a-dihydro-4H-benzo[g]indazol-7-one.
| Compound Name | (5aR,9aR)-8-isocyano-2,6,6,9a-tetramethyl-3-naphthalen-1-yl-5,5a-dihydro-4H-benzo[g]indazol-7-one |
|---|---|
| PubChem CID | 88858786 |
| Molecular Formula | C26H25N3O |
| Molecular Weight | 395.51 g/mol |
| Exact Mass | 395.20 |
| IUPAC Name | (5aR,9aR)-8-isocyano-2,6,6,9a-tetramethyl-3-naphthalen-1-yl-5,5a-dihydro-4H-benzo[g]indazol-7-one |
| SMILES | [C-]#[N+]C1=C[C@]2(C)c3nn(C)c(-c4cccc5ccccc45)c3CC[C@H]2C(C)(C)C1=O |
| InChI | InChI=1S/C26H25N3O/c1-25(2)21-14-13-19-22(18-12-8-10-16-9-6-7-11-17(16)18)29(5)28-23(19)26(21,3)15-20(27-4)24(25)30/h6-12,15,21H,13-14H2,1-3,5H3/t21-,26-/m0/s1 |
| InChIKey | XALNOPIDLNOIFR-LVXARBLLSA-N |
| XLogP | 5.47 |
| TPSA | 39.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.51 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|