C23H23N3O2 — CID 88858787
(5aR,9aR)-2-acetyl-8-isocyano-6,6,9a-trimethyl-3-phenyl-5,5a-dihydro-4H-benzo[g]indazol-7-one (PubChem CID 88858787) has the molecular formula C23H23N3O2 and a molecular weight of 373.46 g/mol. Its IUPAC name is (5aR,9aR)-2-acetyl-8-isocyano-6,6,9a-trimethyl-3-phenyl-5,5a-dihydro-4H-benzo[g]indazol-7-one.
| Compound Name | (5aR,9aR)-2-acetyl-8-isocyano-6,6,9a-trimethyl-3-phenyl-5,5a-dihydro-4H-benzo[g]indazol-7-one |
|---|---|
| PubChem CID | 88858787 |
| Molecular Formula | C23H23N3O2 |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | (5aR,9aR)-2-acetyl-8-isocyano-6,6,9a-trimethyl-3-phenyl-5,5a-dihydro-4H-benzo[g]indazol-7-one |
| SMILES | [C-]#[N+]C1=C[C@]2(C)c3nn(C(C)=O)c(-c4ccccc4)c3CC[C@H]2C(C)(C)C1=O |
| InChI | InChI=1S/C23H23N3O2/c1-14(27)26-19(15-9-7-6-8-10-15)16-11-12-18-22(2,3)21(28)17(24-5)13-23(18,4)20(16)25-26/h6-10,13,18H,11-12H2,1-4H3/t18-,23-/m0/s1 |
| InChIKey | SFLRWMUCVZDNEZ-MBSDFSHPSA-N |
| XLogP | 4.44 |
| TPSA | 56.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|