C22H25N3O2 — CID 88858792
(5aR,9aR)-3-(2,4-dimethylfuran-3-yl)-8-isocyano-2,6,6,9a-tetramethyl-5,5a-dihydro-4H-benzo[g]indazol-7-one (PubChem CID 88858792) has the molecular formula C22H25N3O2 and a molecular weight of 363.46 g/mol. Its IUPAC name is (5aR,9aR)-3-(2,4-dimethylfuran-3-yl)-8-isocyano-2,6,6,9a-tetramethyl-5,5a-dihydro-4H-benzo[g]indazol-7-one.
| Compound Name | (5aR,9aR)-3-(2,4-dimethylfuran-3-yl)-8-isocyano-2,6,6,9a-tetramethyl-5,5a-dihydro-4H-benzo[g]indazol-7-one |
|---|---|
| PubChem CID | 88858792 |
| Molecular Formula | C22H25N3O2 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.19 |
| IUPAC Name | (5aR,9aR)-3-(2,4-dimethylfuran-3-yl)-8-isocyano-2,6,6,9a-tetramethyl-5,5a-dihydro-4H-benzo[g]indazol-7-one |
| SMILES | [C-]#[N+]C1=C[C@]2(C)c3nn(C)c(-c4c(C)coc4C)c3CC[C@H]2C(C)(C)C1=O |
| InChI | InChI=1S/C22H25N3O2/c1-12-11-27-13(2)17(12)18-14-8-9-16-21(3,4)20(26)15(23-6)10-22(16,5)19(14)24-25(18)7/h10-11,16H,8-9H2,1-5,7H3/t16-,22-/m0/s1 |
| InChIKey | XGHGJWRPZBMJCT-AOMKIAJQSA-N |
| XLogP | 4.53 |
| TPSA | 52.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|