C17H20N4O — CID 88858856
(6aS,7S,10aR)-9-isocyano-2,7,10a-trimethyl-4-(methylamino)-5,6,6a,7-tetrahydrobenzo[h]quinazolin-8-one (PubChem CID 88858856) has the molecular formula C17H20N4O and a molecular weight of 296.37 g/mol. Its IUPAC name is (6aS,7S,10aR)-9-isocyano-2,7,10a-trimethyl-4-(methylamino)-5,6,6a,7-tetrahydrobenzo[h]quinazolin-8-one.
| Compound Name | (6aS,7S,10aR)-9-isocyano-2,7,10a-trimethyl-4-(methylamino)-5,6,6a,7-tetrahydrobenzo[h]quinazolin-8-one |
|---|---|
| PubChem CID | 88858856 |
| Molecular Formula | C17H20N4O |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | (6aS,7S,10aR)-9-isocyano-2,7,10a-trimethyl-4-(methylamino)-5,6,6a,7-tetrahydrobenzo[h]quinazolin-8-one |
| SMILES | [C-]#[N+]C1=C[C@]2(C)c3nc(C)nc(NC)c3CC[C@H]2[C@H](C)C1=O |
| InChI | InChI=1S/C17H20N4O/c1-9-12-7-6-11-15(20-10(2)21-16(11)19-5)17(12,3)8-13(18-4)14(9)22/h8-9,12H,6-7H2,1-3,5H3,(H,19,20,21)/t9-,12-,17-/m0/s1 |
| InChIKey | DJVMBUPFOINUQC-OVSFNBESSA-N |
| XLogP | 2.67 |
| TPSA | 59.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|