C18H21N3O2 — CID 88858906
(6aR,10aR)-9-isocyano-2,3,7,7,10a-pentamethyl-6,6a-dihydro-5H-benzo[h]quinazoline-4,8-dione (PubChem CID 88858906) has the molecular formula C18H21N3O2 and a molecular weight of 311.39 g/mol. Its IUPAC name is (6aR,10aR)-9-isocyano-2,3,7,7,10a-pentamethyl-6,6a-dihydro-5H-benzo[h]quinazoline-4,8-dione.
| Compound Name | (6aR,10aR)-9-isocyano-2,3,7,7,10a-pentamethyl-6,6a-dihydro-5H-benzo[h]quinazoline-4,8-dione |
|---|---|
| PubChem CID | 88858906 |
| Molecular Formula | C18H21N3O2 |
| Molecular Weight | 311.39 g/mol |
| Exact Mass | 311.16 |
| IUPAC Name | (6aR,10aR)-9-isocyano-2,3,7,7,10a-pentamethyl-6,6a-dihydro-5H-benzo[h]quinazoline-4,8-dione |
| SMILES | [C-]#[N+]C1=C[C@]2(C)c3nc(C)n(C)c(=O)c3CC[C@H]2C(C)(C)C1=O |
| InChI | InChI=1S/C18H21N3O2/c1-10-20-14-11(16(23)21(10)6)7-8-13-17(2,3)15(22)12(19-5)9-18(13,14)4/h9,13H,7-8H2,1-4,6H3/t13-,18-/m0/s1 |
| InChIKey | OVNWZYXBNLBHFP-UGSOOPFHSA-N |
| XLogP | 2.32 |
| TPSA | 56.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.39 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|