C17H19N3O3 — CID 88858919
(5aR,9aR)-8-isocyano-2,6,6,9a-tetramethyl-7-oxo-5,5a-dihydro-4H-benzo[g]indazole-3-carboxylic acid (PubChem CID 88858919) has the molecular formula C17H19N3O3 and a molecular weight of 313.36 g/mol. Its IUPAC name is (5aR,9aR)-8-isocyano-2,6,6,9a-tetramethyl-7-oxo-5,5a-dihydro-4H-benzo[g]indazole-3-carboxylic acid.
| Compound Name | (5aR,9aR)-8-isocyano-2,6,6,9a-tetramethyl-7-oxo-5,5a-dihydro-4H-benzo[g]indazole-3-carboxylic acid |
|---|---|
| PubChem CID | 88858919 |
| Molecular Formula | C17H19N3O3 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | (5aR,9aR)-8-isocyano-2,6,6,9a-tetramethyl-7-oxo-5,5a-dihydro-4H-benzo[g]indazole-3-carboxylic acid |
| SMILES | [C-]#[N+]C1=C[C@]2(C)c3nn(C)c(C(=O)O)c3CC[C@H]2C(C)(C)C1=O |
| InChI | InChI=1S/C17H19N3O3/c1-16(2)11-7-6-9-12(15(22)23)20(5)19-13(9)17(11,3)8-10(18-4)14(16)21/h8,11H,6-7H2,1-3,5H3,(H,22,23)/t11-,17-/m0/s1 |
| InChIKey | TVGYNYGZMYFXGO-GTNSWQLSSA-N |
| XLogP | 2.35 |
| TPSA | 76.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|