C15H19N3O — CID 88858946
(5aR,9aS)-8-isocyano-6,6,9a-trimethyl-4,5,5a,9-tetrahydro-1H-benzo[g]indazol-7-ol (PubChem CID 88858946) has the molecular formula C15H19N3O and a molecular weight of 257.34 g/mol. Its IUPAC name is (5aR,9aS)-8-isocyano-6,6,9a-trimethyl-4,5,5a,9-tetrahydro-1H-benzo[g]indazol-7-ol.
| Compound Name | (5aR,9aS)-8-isocyano-6,6,9a-trimethyl-4,5,5a,9-tetrahydro-1H-benzo[g]indazol-7-ol |
|---|---|
| PubChem CID | 88858946 |
| Molecular Formula | C15H19N3O |
| Molecular Weight | 257.34 g/mol |
| Exact Mass | 257.15 |
| IUPAC Name | (5aR,9aS)-8-isocyano-6,6,9a-trimethyl-4,5,5a,9-tetrahydro-1H-benzo[g]indazol-7-ol |
| SMILES | [C-]#[N+]C1=C(O)C(C)(C)[C@@H]2CCc3cn[nH]c3[C@@]2(C)C1 |
| InChI | InChI=1S/C15H19N3O/c1-14(2)11-6-5-9-8-17-18-12(9)15(11,3)7-10(16-4)13(14)19/h8,11,19H,5-7H2,1-3H3,(H,17,18)/t11-,15-/m0/s1 |
| InChIKey | WMLAOILWAALECC-NHYWBVRUSA-N |
| XLogP | 3.35 |
| TPSA | 53.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.34 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|