C14H17N3O — CID 88858968
(4aS,5S,8aS)-7-isocyano-2,5,8a-trimethyl-4,4a,5,8-tetrahydroindeno[1,2-c]pyrazol-6-ol (PubChem CID 88858968) has the molecular formula C14H17N3O and a molecular weight of 243.31 g/mol. Its IUPAC name is (4aS,5S,8aS)-7-isocyano-2,5,8a-trimethyl-4,4a,5,8-tetrahydroindeno[1,2-c]pyrazol-6-ol.
| Compound Name | (4aS,5S,8aS)-7-isocyano-2,5,8a-trimethyl-4,4a,5,8-tetrahydroindeno[1,2-c]pyrazol-6-ol |
|---|---|
| PubChem CID | 88858968 |
| Molecular Formula | C14H17N3O |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.14 |
| IUPAC Name | (4aS,5S,8aS)-7-isocyano-2,5,8a-trimethyl-4,4a,5,8-tetrahydroindeno[1,2-c]pyrazol-6-ol |
| SMILES | [C-]#[N+]C1=C(O)[C@@H](C)[C@@H]2Cc3cn(C)nc3[C@@]2(C)C1 |
| InChI | InChI=1S/C14H17N3O/c1-8-10-5-9-7-17(4)16-13(9)14(10,2)6-11(15-3)12(8)18/h7-8,10,18H,5-6H2,1-2,4H3/t8-,10-,14-/m0/s1 |
| InChIKey | FGMMTWXMOAICLX-BXGCZWRVSA-N |
| XLogP | 2.58 |
| TPSA | 42.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|