C15H19N3O — CID 88858969
(4aR,8aS)-7-isocyano-2,5,5,8a-tetramethyl-4a,8-dihydro-4H-indeno[1,2-c]pyrazol-6-ol (PubChem CID 88858969) has the molecular formula C15H19N3O and a molecular weight of 257.34 g/mol. Its IUPAC name is (4aR,8aS)-7-isocyano-2,5,5,8a-tetramethyl-4a,8-dihydro-4H-indeno[1,2-c]pyrazol-6-ol.
| Compound Name | (4aR,8aS)-7-isocyano-2,5,5,8a-tetramethyl-4a,8-dihydro-4H-indeno[1,2-c]pyrazol-6-ol |
|---|---|
| PubChem CID | 88858969 |
| Molecular Formula | C15H19N3O |
| Molecular Weight | 257.34 g/mol |
| Exact Mass | 257.15 |
| IUPAC Name | (4aR,8aS)-7-isocyano-2,5,5,8a-tetramethyl-4a,8-dihydro-4H-indeno[1,2-c]pyrazol-6-ol |
| SMILES | [C-]#[N+]C1=C(O)C(C)(C)[C@@H]2Cc3cn(C)nc3[C@@]2(C)C1 |
| InChI | InChI=1S/C15H19N3O/c1-14(2)11-6-9-8-18(5)17-12(9)15(11,3)7-10(16-4)13(14)19/h8,11,19H,6-7H2,1-3,5H3/t11-,15-/m0/s1 |
| InChIKey | QKXHDFPRDWMRTA-NHYWBVRUSA-N |
| XLogP | 2.97 |
| TPSA | 42.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.34 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|