C19H24N4O3 — CID 88858980
(5aR,9aS)-2,6,6,9a-tetramethyl-3-(5-methyl-1,3,4-oxadiazol-2-yl)-7-oxo-5,5a,8,9-tetrahydro-4H-benzo[g]indazole-8-carbaldehyde (PubChem CID 88858980) has the molecular formula C19H24N4O3 and a molecular weight of 356.43 g/mol. Its IUPAC name is (5aR,9aS)-2,6,6,9a-tetramethyl-3-(5-methyl-1,3,4-oxadiazol-2-yl)-7-oxo-5,5a,8,9-tetrahydro-4H-benzo[g]indazole-8-carbaldehyde.
| Compound Name | (5aR,9aS)-2,6,6,9a-tetramethyl-3-(5-methyl-1,3,4-oxadiazol-2-yl)-7-oxo-5,5a,8,9-tetrahydro-4H-benzo[g]indazole-8-carbaldehyde |
|---|---|
| PubChem CID | 88858980 |
| Molecular Formula | C19H24N4O3 |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.18 |
| IUPAC Name | (5aR,9aS)-2,6,6,9a-tetramethyl-3-(5-methyl-1,3,4-oxadiazol-2-yl)-7-oxo-5,5a,8,9-tetrahydro-4H-benzo[g]indazole-8-carbaldehyde |
| SMILES | Cc1nnc(-c2c3c(nn2C)[C@@]2(C)CC(C=O)C(=O)C(C)(C)[C@@H]2CC3)o1 |
| InChI | InChI=1S/C19H24N4O3/c1-10-20-21-17(26-10)14-12-6-7-13-18(2,3)16(25)11(9-24)8-19(13,4)15(12)22-23(14)5/h9,11,13H,6-8H2,1-5H3/t11?,13-,19-/m0/s1 |
| InChIKey | WCVJKFVCQZYDJZ-SLXDHHJASA-N |
| XLogP | 2.41 |
| TPSA | 90.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|