C18H20N4O — CID 88858991
(2S,7R)-4-isocyano-2,6,6-trimethyl-12,16,17-triazatetracyclo[8.7.0.02,7.013,17]heptadeca-1(10),11,13,15-tetraen-5-one (PubChem CID 88858991) has the molecular formula C18H20N4O and a molecular weight of 308.38 g/mol. Its IUPAC name is (2S,7R)-4-isocyano-2,6,6-trimethyl-12,16,17-triazatetracyclo[8.7.0.02,7.013,17]heptadeca-1(10),11,13,15-tetraen-5-one.
| Compound Name | (2S,7R)-4-isocyano-2,6,6-trimethyl-12,16,17-triazatetracyclo[8.7.0.02,7.013,17]heptadeca-1(10),11,13,15-tetraen-5-one |
|---|---|
| PubChem CID | 88858991 |
| Molecular Formula | C18H20N4O |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | (2S,7R)-4-isocyano-2,6,6-trimethyl-12,16,17-triazatetracyclo[8.7.0.02,7.013,17]heptadeca-1(10),11,13,15-tetraen-5-one |
| SMILES | [C-]#[N+]C1C[C@]2(C)c3c(cnc4ccnn34)CC[C@H]2C(C)(C)C1=O |
| InChI | InChI=1S/C18H20N4O/c1-17(2)13-6-5-11-10-20-14-7-8-21-22(14)15(11)18(13,3)9-12(19-4)16(17)23/h7-8,10,12-13H,5-6,9H2,1-3H3/t12?,13-,18-/m0/s1 |
| InChIKey | BGRXIMSXGMBCLH-UAGUUWOPSA-N |
| XLogP | 2.84 |
| TPSA | 51.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|