C25H27F6N3O5 — CID 88859092
2,2,2-trifluoro-1-[1'-[3-methoxy-4-[2-(trifluoromethoxy)ethoxy]benzoyl]-4-methylspiro[3,4-dihydro-2H-pyrrolo[1,2-a]pyrazine-1,4'-piperidine]-6-yl]ethanone (PubChem CID 88859092) has the molecular formula C25H27F6N3O5 and a molecular weight of 563.50 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-[1'-[3-methoxy-4-[2-(trifluoromethoxy)ethoxy]benzoyl]-4-methylspiro[3,4-dihydro-2H-pyrrolo[1,2-a]pyrazine-1,4'-piperidine]-6-yl]ethanone.
| Compound Name | 2,2,2-trifluoro-1-[1'-[3-methoxy-4-[2-(trifluoromethoxy)ethoxy]benzoyl]-4-methylspiro[3,4-dihydro-2H-pyrrolo[1,2-a]pyrazine-1,4'-piperidine]-6-yl]ethanone |
|---|---|
| PubChem CID | 88859092 |
| Molecular Formula | C25H27F6N3O5 |
| Molecular Weight | 563.50 g/mol |
| Exact Mass | 563.19 |
| IUPAC Name | 2,2,2-trifluoro-1-[1'-[3-methoxy-4-[2-(trifluoromethoxy)ethoxy]benzoyl]-4-methylspiro[3,4-dihydro-2H-pyrrolo[1,2-a]pyrazine-1,4'-piperidine]-6-yl]ethanone |
| SMILES | COc1cc(C(=O)N2CCC3(CC2)NCC(C)n2c(C(=O)C(F)(F)F)ccc23)ccc1OCCOC(F)(F)F |
| InChI | InChI=1S/C25H27F6N3O5/c1-15-14-32-23(20-6-4-17(34(15)20)21(35)24(26,27)28)7-9-33(10-8-23)22(36)16-3-5-18(19(13-16)37-2)38-11-12-39-25(29,30)31/h3-6,13,15,32H,7-12,14H2,1-2H3 |
| InChIKey | WAWGCWMSAPTNOO-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 82.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.50 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|