C32H50O11S — CID 88859306
2-[(4R)-4-[(8R,9S,14S,17R)-3,7,12-triacetyloxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoyl]oxyethanesulfonic acid (PubChem CID 88859306) has the molecular formula C32H50O11S and a molecular weight of 642.81 g/mol. Its IUPAC name is 2-[(4R)-4-[(8R,9S,14S,17R)-3,7,12-triacetyloxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoyl]oxyethanesulfonic acid.
| Compound Name | 2-[(4R)-4-[(8R,9S,14S,17R)-3,7,12-triacetyloxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoyl]oxyethanesulfonic acid |
|---|---|
| PubChem CID | 88859306 |
| Molecular Formula | C32H50O11S |
| Molecular Weight | 642.81 g/mol |
| Exact Mass | 642.31 |
| IUPAC Name | 2-[(4R)-4-[(8R,9S,14S,17R)-3,7,12-triacetyloxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoyl]oxyethanesulfonic acid |
| SMILES | CC(=O)OC1CCC2(C)C(C1)CC(OC(C)=O)[C@@H]1[C@@H]2CC(OC(C)=O)C2(C)[C@@H]([C@H](C)CCC(=O)OCCS(=O)(=O)O)CC[C@@H]12 |
| InChI | InChI=1S/C32H50O11S/c1-18(7-10-29(36)40-13-14-44(37,38)39)24-8-9-25-30-26(17-28(32(24,25)6)43-21(4)35)31(5)12-11-23(41-19(2)33)15-22(31)16-27(30)42-20(3)34/h18,22-28,30H,7-17H2,1-6H3,(H,37,38,39)/t18-,22?,23?,24-,25+,26+,27?,28?,30+,31?,32?/m1/s1 |
| InChIKey | PWRZHWGJECYMPL-MHBYQQIESA-N |
| XLogP | 4.51 |
| TPSA | 159.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.81 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|