About 2-methylpropoxycarbonyl (Z)-3-[3-(2-chloro-6-methoxy-4-pyridinyl)-1,2,4-triazol-1-yl]prop-2-enoate
2-methylpropoxycarbonyl (Z)-3-[3-(2-chloro-6-methoxy-4-pyridinyl)-1,2,4-triazol-1-yl]prop-2-enoate (PubChem CID 88859629) has the molecular formula C16H17ClN4O5
and a molecular weight of 380.79 g/mol. Its IUPAC name is 2-methylpropoxycarbonyl (Z)-3-[3-(2-chloro-6-methoxy-4-pyridinyl)-1,2,4-triazol-1-yl]prop-2-enoate.
Molecular Properties
| Compound Name | 2-methylpropoxycarbonyl (Z)-3-[3-(2-chloro-6-methoxy-4-pyridinyl)-1,2,4-triazol-1-yl]prop-2-enoate |
| PubChem CID | 88859629 |
| Molecular Formula | C16H17ClN4O5 |
| Molecular Weight | 380.79 g/mol |
| Exact Mass | 380.09 |
| IUPAC Name | 2-methylpropoxycarbonyl (Z)-3-[3-(2-chloro-6-methoxy-4-pyridinyl)-1,2,4-triazol-1-yl]prop-2-enoate |
| SMILES | COc1cc(-c2ncn(/C=C\C(=O)OC(=O)OCC(C)C)n2)cc(Cl)n1 |
| InChI | InChI=1S/C16H17ClN4O5/c1-10(2)8-25-16(23)26-14(22)4-5-21-9-18-15(20-21)11-6-12(17)19-13(7-11)24-3/h4-7,9-10H,8H2,1-3H3/b5-4- |
| InChIKey | MZMNCAKABADYDH-PLNGDYQASA-N |
| XLogP | 2.81 |
| TPSA | 105.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.79 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-methylpropoxycarbonyl (Z)-3-[3-(2-chloro-6-methoxy-4-pyridinyl)-1,2,4-triazol-1-yl]prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropoxycarbonyl (Z)-3-[3-(2-chloro-6-methoxy-4-pyridinyl)-1,2,4-triazol-1-yl]prop-2-enoate?
The IUPAC name of 2-methylpropoxycarbonyl (Z)-3-[3-(2-chloro-6-methoxy-4-pyridinyl)-1,2,4-triazol-1-yl]prop-2-enoate (CID 88859629) is 2-methylpropoxycarbonyl (Z)-3-[3-(2-chloro-6-methoxy-4-pyridinyl)-1,2,4-triazol-1-yl]prop-2-enoate.
What is the SMILES notation for 2-methylpropoxycarbonyl (Z)-3-[3-(2-chloro-6-methoxy-4-pyridinyl)-1,2,4-triazol-1-yl]prop-2-enoate?
The canonical SMILES for 2-methylpropoxycarbonyl (Z)-3-[3-(2-chloro-6-methoxy-4-pyridinyl)-1,2,4-triazol-1-yl]prop-2-enoate is COc1cc(-c2ncn(/C=C\C(=O)OC(=O)OCC(C)C)n2)cc(Cl)n1.
What is the InChIKey of 2-methylpropoxycarbonyl (Z)-3-[3-(2-chloro-6-methoxy-4-pyridinyl)-1,2,4-triazol-1-yl]prop-2-enoate?
The InChIKey is MZMNCAKABADYDH-PLNGDYQASA-N. The full InChI is InChI=1S/C16H17ClN4O5/c1-10(2)8-25-16(23)26-14(22)4-5-21-9-18-15(20-21)11-6-12(17)19-13(7-11)24-3/h4-7,9-10H,8H2,1-3H3/b5-4-.
What are the key properties of 2-methylpropoxycarbonyl (Z)-3-[3-(2-chloro-6-methoxy-4-pyridinyl)-1,2,4-triazol-1-yl]prop-2-enoate?
2-methylpropoxycarbonyl (Z)-3-[3-(2-chloro-6-methoxy-4-pyridinyl)-1,2,4-triazol-1-yl]prop-2-enoate has a molecular weight of 380.79 g/mol, XLogP of 2.81, 6 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropoxycarbonyl (Z)-3-[3-(2-chloro-6-methoxy-4-pyridinyl)-1,2,4-triazol-1-yl]prop-2-enoate is sourced from PubChem (CID 88859629), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).