About dimethyl (2Z)-2-[2-(3,3-dimethylbutylamino)-2-oxoethylidene]butanedioate
dimethyl (2Z)-2-[2-(3,3-dimethylbutylamino)-2-oxoethylidene]butanedioate (PubChem CID 88860049) has the molecular formula C14H23NO5
and a molecular weight of 285.34 g/mol. Its IUPAC name is dimethyl (2Z)-2-[2-(3,3-dimethylbutylamino)-2-oxoethylidene]butanedioate.
Molecular Properties
| Compound Name | dimethyl (2Z)-2-[2-(3,3-dimethylbutylamino)-2-oxoethylidene]butanedioate |
| PubChem CID | 88860049 |
| Molecular Formula | C14H23NO5 |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.16 |
| IUPAC Name | dimethyl (2Z)-2-[2-(3,3-dimethylbutylamino)-2-oxoethylidene]butanedioate |
| SMILES | COC(=O)C/C(=C/C(=O)NCCC(C)(C)C)C(=O)OC |
| InChI | InChI=1S/C14H23NO5/c1-14(2,3)6-7-15-11(16)8-10(13(18)20-5)9-12(17)19-4/h8H,6-7,9H2,1-5H3,(H,15,16)/b10-8- |
| InChIKey | WMTMNXNUWVGEPA-NTMALXAHSA-N |
| XLogP | 1.20 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze dimethyl (2Z)-2-[2-(3,3-dimethylbutylamino)-2-oxoethylidene]butanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl (2Z)-2-[2-(3,3-dimethylbutylamino)-2-oxoethylidene]butanedioate?
The IUPAC name of dimethyl (2Z)-2-[2-(3,3-dimethylbutylamino)-2-oxoethylidene]butanedioate (CID 88860049) is dimethyl (2Z)-2-[2-(3,3-dimethylbutylamino)-2-oxoethylidene]butanedioate.
What is the SMILES notation for dimethyl (2Z)-2-[2-(3,3-dimethylbutylamino)-2-oxoethylidene]butanedioate?
The canonical SMILES for dimethyl (2Z)-2-[2-(3,3-dimethylbutylamino)-2-oxoethylidene]butanedioate is COC(=O)C/C(=C/C(=O)NCCC(C)(C)C)C(=O)OC.
What is the InChIKey of dimethyl (2Z)-2-[2-(3,3-dimethylbutylamino)-2-oxoethylidene]butanedioate?
The InChIKey is WMTMNXNUWVGEPA-NTMALXAHSA-N. The full InChI is InChI=1S/C14H23NO5/c1-14(2,3)6-7-15-11(16)8-10(13(18)20-5)9-12(17)19-4/h8H,6-7,9H2,1-5H3,(H,15,16)/b10-8-.
What are the key properties of dimethyl (2Z)-2-[2-(3,3-dimethylbutylamino)-2-oxoethylidene]butanedioate?
dimethyl (2Z)-2-[2-(3,3-dimethylbutylamino)-2-oxoethylidene]butanedioate has a molecular weight of 285.34 g/mol, XLogP of 1.20, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl (2Z)-2-[2-(3,3-dimethylbutylamino)-2-oxoethylidene]butanedioate is sourced from PubChem (CID 88860049), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).