C9H7F11O2 — CID 88860218
1,1,2,2-tetrafluoro-1-[2,2,3,3-tetrafluoro-3-(1,2,2-trifluoroethenoxy)propoxy]butane (PubChem CID 88860218) has the molecular formula C9H7F11O2 and a molecular weight of 356.13 g/mol. Its IUPAC name is 1,1,2,2-tetrafluoro-1-[2,2,3,3-tetrafluoro-3-(1,2,2-trifluoroethenoxy)propoxy]butane.
| Compound Name | 1,1,2,2-tetrafluoro-1-[2,2,3,3-tetrafluoro-3-(1,2,2-trifluoroethenoxy)propoxy]butane |
|---|---|
| PubChem CID | 88860218 |
| Molecular Formula | C9H7F11O2 |
| Molecular Weight | 356.13 g/mol |
| Exact Mass | 356.03 |
| IUPAC Name | 1,1,2,2-tetrafluoro-1-[2,2,3,3-tetrafluoro-3-(1,2,2-trifluoroethenoxy)propoxy]butane |
| SMILES | CCC(F)(F)C(F)(F)OCC(F)(F)C(F)(F)OC(F)=C(F)F |
| InChI | InChI=1S/C9H7F11O2/c1-2-6(13,14)8(17,18)21-3-7(15,16)9(19,20)22-5(12)4(10)11/h2-3H2,1H3 |
| InChIKey | VIBJMRUIHDRIFH-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.13 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|