C10H14ClFO — CID 88860273
(3Z,5Z)-3-chloro-4-(2-fluoroethoxy)octa-1,3,5-triene (PubChem CID 88860273) has the molecular formula C10H14ClFO and a molecular weight of 204.67 g/mol. Its IUPAC name is (3Z,5Z)-3-chloro-4-(2-fluoroethoxy)octa-1,3,5-triene.
| Compound Name | (3Z,5Z)-3-chloro-4-(2-fluoroethoxy)octa-1,3,5-triene |
|---|---|
| PubChem CID | 88860273 |
| Molecular Formula | C10H14ClFO |
| Molecular Weight | 204.67 g/mol |
| Exact Mass | 204.07 |
| IUPAC Name | (3Z,5Z)-3-chloro-4-(2-fluoroethoxy)octa-1,3,5-triene |
| SMILES | C=C/C(Cl)=C(\C=C/CC)OCCF |
| InChI | InChI=1S/C10H14ClFO/c1-3-5-6-10(9(11)4-2)13-8-7-12/h4-6H,2-3,7-8H2,1H3/b6-5-,10-9- |
| InChIKey | LDPWYBGHYQDVGJ-WBHJMADESA-N |
| XLogP | 3.58 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.67 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|