C9H14N2 — CID 88860380
(2Z,4Z)-2-methyl-1-methyliminohepta-2,4,6-trien-3-amine (PubChem CID 88860380) has the molecular formula C9H14N2 and a molecular weight of 150.22 g/mol. Its IUPAC name is (2Z,4Z)-2-methyl-1-methyliminohepta-2,4,6-trien-3-amine.
| Compound Name | (2Z,4Z)-2-methyl-1-methyliminohepta-2,4,6-trien-3-amine |
|---|---|
| PubChem CID | 88860380 |
| Molecular Formula | C9H14N2 |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.12 |
| IUPAC Name | (2Z,4Z)-2-methyl-1-methyliminohepta-2,4,6-trien-3-amine |
| SMILES | C=C/C=C\C(N)=C(C)\C=N\C |
| InChI | InChI=1S/C9H14N2/c1-4-5-6-9(10)8(2)7-11-3/h4-7H,1,10H2,2-3H3/b6-5-,9-8-,11-7+ |
| InChIKey | AIVWYDTWIZBUJT-VZUXIAFRSA-N |
| XLogP | 1.66 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|