C21H20Cl2F3NO3 — CID 88860469
ethyl 4-[(E)-N-[2-(3,5-dichlorophenyl)-1,1,1-trifluoropropan-2-yl]oxy-C-methylcarbonimidoyl]-2-methylbenzoate (PubChem CID 88860469) has the molecular formula C21H20Cl2F3NO3 and a molecular weight of 462.30 g/mol. Its IUPAC name is ethyl 4-[(E)-N-[2-(3,5-dichlorophenyl)-1,1,1-trifluoropropan-2-yl]oxy-C-methylcarbonimidoyl]-2-methylbenzoate.
| Compound Name | ethyl 4-[(E)-N-[2-(3,5-dichlorophenyl)-1,1,1-trifluoropropan-2-yl]oxy-C-methylcarbonimidoyl]-2-methylbenzoate |
|---|---|
| PubChem CID | 88860469 |
| Molecular Formula | C21H20Cl2F3NO3 |
| Molecular Weight | 462.30 g/mol |
| Exact Mass | 461.08 |
| IUPAC Name | ethyl 4-[(E)-N-[2-(3,5-dichlorophenyl)-1,1,1-trifluoropropan-2-yl]oxy-C-methylcarbonimidoyl]-2-methylbenzoate |
| SMILES | CCOC(=O)c1ccc(/C(C)=N/OC(C)(c2cc(Cl)cc(Cl)c2)C(F)(F)F)cc1C |
| InChI | InChI=1S/C21H20Cl2F3NO3/c1-5-29-19(28)18-7-6-14(8-12(18)2)13(3)27-30-20(4,21(24,25)26)15-9-16(22)11-17(23)10-15/h6-11H,5H2,1-4H3/b27-13+ |
| InChIKey | LZIXGQATMWJDHQ-UVHMKAGCSA-N |
| XLogP | 6.70 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.30 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|