2,3,5,6-tetrafluorocyclohexa-1,3-diene-1-sulfonic acid

C6H4F4O3S — CID 88860475

IUPAC2,3,5,6-tetrafluorocyclohexa-1,3-diene-1-sulfonic acid
SMILESO=S(=O)(O)C1=C(F)C(F)=CC(F)C1F
InChIInChI=1S/C6H4F4O3S/c7-2-1-3(8)5(10)6(4(2)9)14(11,12)13/h1-2,4H,(H,11,12,13)
InChIKeyUIRWTQUWVRIKON-UHFFFAOYSA-N
MW232.15 g/mol
LogP1.60
Rot. Bonds1

About 2,3,5,6-tetrafluorocyclohexa-1,3-diene-1-sulfonic acid

2,3,5,6-tetrafluorocyclohexa-1,3-diene-1-sulfonic acid (PubChem CID 88860475) has the molecular formula C6H4F4O3S and a molecular weight of 232.15 g/mol. Its IUPAC name is 2,3,5,6-tetrafluorocyclohexa-1,3-diene-1-sulfonic acid.

Molecular Properties

Compound Name2,3,5,6-tetrafluorocyclohexa-1,3-diene-1-sulfonic acid
PubChem CID88860475
Molecular FormulaC6H4F4O3S
Molecular Weight232.15 g/mol
Exact Mass231.98
IUPAC Name2,3,5,6-tetrafluorocyclohexa-1,3-diene-1-sulfonic acid
SMILESO=S(=O)(O)C1=C(F)C(F)=CC(F)C1F
InChIInChI=1S/C6H4F4O3S/c7-2-1-3(8)5(10)6(4(2)9)14(11,12)13/h1-2,4H,(H,11,12,13)
InChIKeyUIRWTQUWVRIKON-UHFFFAOYSA-N
XLogP1.60
TPSA54.37 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500232.15
LogP ≤ 51.60
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze 2,3,5,6-tetrafluorocyclohexa-1,3-diene-1-sulfonic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,3,5,6-tetrafluorocyclohexa-1,3-diene-1-sulfonic acid?
The IUPAC name of 2,3,5,6-tetrafluorocyclohexa-1,3-diene-1-sulfonic acid (CID 88860475) is 2,3,5,6-tetrafluorocyclohexa-1,3-diene-1-sulfonic acid.
What is the SMILES notation for 2,3,5,6-tetrafluorocyclohexa-1,3-diene-1-sulfonic acid?
The canonical SMILES for 2,3,5,6-tetrafluorocyclohexa-1,3-diene-1-sulfonic acid is O=S(=O)(O)C1=C(F)C(F)=CC(F)C1F.
What is the InChIKey of 2,3,5,6-tetrafluorocyclohexa-1,3-diene-1-sulfonic acid?
The InChIKey is UIRWTQUWVRIKON-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4F4O3S/c7-2-1-3(8)5(10)6(4(2)9)14(11,12)13/h1-2,4H,(H,11,12,13).
What are the key properties of 2,3,5,6-tetrafluorocyclohexa-1,3-diene-1-sulfonic acid?
2,3,5,6-tetrafluorocyclohexa-1,3-diene-1-sulfonic acid has a molecular weight of 232.15 g/mol, XLogP of 1.60, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3,5,6-tetrafluorocyclohexa-1,3-diene-1-sulfonic acid is sourced from PubChem (CID 88860475), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).