C21H10O5 — CID 88860671
6,8-dimethyl-2,12,17-trioxopentacyclo[11.3.1.05,16.07,15.09,14]heptadeca-1(16),3,5,7(15),8,10,13-heptaene-3,11-dicarbaldehyde (PubChem CID 88860671) has the molecular formula C21H10O5 and a molecular weight of 342.31 g/mol. Its IUPAC name is 6,8-dimethyl-2,12,17-trioxopentacyclo[11.3.1.05,16.07,15.09,14]heptadeca-1(16),3,5,7(15),8,10,13-heptaene-3,11-dicarbaldehyde.
| Compound Name | 6,8-dimethyl-2,12,17-trioxopentacyclo[11.3.1.05,16.07,15.09,14]heptadeca-1(16),3,5,7(15),8,10,13-heptaene-3,11-dicarbaldehyde |
|---|---|
| PubChem CID | 88860671 |
| Molecular Formula | C21H10O5 |
| Molecular Weight | 342.31 g/mol |
| Exact Mass | 342.05 |
| IUPAC Name | 6,8-dimethyl-2,12,17-trioxopentacyclo[11.3.1.05,16.07,15.09,14]heptadeca-1(16),3,5,7(15),8,10,13-heptaene-3,11-dicarbaldehyde |
| SMILES | Cc1c2c(C)c3cc(C=O)c(=O)c4c(=O)c5c(=O)c(C=O)cc1c5c=2c34 |
| InChI | InChI=1S/C21H10O5/c1-7-11-3-9(5-22)19(24)17-14(11)16-13(7)8(2)12-4-10(6-23)20(25)18(15(12)16)21(17)26/h3-6H,1-2H3 |
| InChIKey | KVNRINARXSOYLB-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 85.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.31 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|