C39H22F6N4 — CID 88860676
2-[3-[1,1,1,3,3,3-hexafluoro-2-[4-(1,10-phenanthrolin-2-yl)phenyl]propan-2-yl]phenyl]-1,10-phenanthroline (PubChem CID 88860676) has the molecular formula C39H22F6N4 and a molecular weight of 660.62 g/mol. Its IUPAC name is 2-[3-[1,1,1,3,3,3-hexafluoro-2-[4-(1,10-phenanthrolin-2-yl)phenyl]propan-2-yl]phenyl]-1,10-phenanthroline.
| Compound Name | 2-[3-[1,1,1,3,3,3-hexafluoro-2-[4-(1,10-phenanthrolin-2-yl)phenyl]propan-2-yl]phenyl]-1,10-phenanthroline |
|---|---|
| PubChem CID | 88860676 |
| Molecular Formula | C39H22F6N4 |
| Molecular Weight | 660.62 g/mol |
| Exact Mass | 660.17 |
| IUPAC Name | 2-[3-[1,1,1,3,3,3-hexafluoro-2-[4-(1,10-phenanthrolin-2-yl)phenyl]propan-2-yl]phenyl]-1,10-phenanthroline |
| SMILES | FC(F)(F)C(c1ccc(-c2ccc3ccc4cccnc4c3n2)cc1)(c1cccc(-c2ccc3ccc4cccnc4c3n2)c1)C(F)(F)F |
| InChI | InChI=1S/C39H22F6N4/c40-38(41,42)37(39(43,44)45,29-16-12-23(13-17-29)31-18-14-26-10-8-24-5-2-20-46-33(24)35(26)48-31)30-7-1-4-28(22-30)32-19-15-27-11-9-25-6-3-21-47-34(25)36(27)49-32/h1-22H |
| InChIKey | PUGPQLNWGHPXRD-UHFFFAOYSA-N |
| XLogP | 10.62 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.62 |
| LogP ≤ 5 | 10.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|