C19H38O2S — CID 88861046
(E,2S,3R)-2-methyl-18-sulfanyloctadec-4-ene-1,3-diol (PubChem CID 88861046) has the molecular formula C19H38O2S and a molecular weight of 330.58 g/mol. Its IUPAC name is (E,2S,3R)-2-methyl-18-sulfanyloctadec-4-ene-1,3-diol.
| Compound Name | (E,2S,3R)-2-methyl-18-sulfanyloctadec-4-ene-1,3-diol |
|---|---|
| PubChem CID | 88861046 |
| Molecular Formula | C19H38O2S |
| Molecular Weight | 330.58 g/mol |
| Exact Mass | 330.26 |
| IUPAC Name | (E,2S,3R)-2-methyl-18-sulfanyloctadec-4-ene-1,3-diol |
| SMILES | C[C@@H](CO)[C@H](O)/C=C/CCCCCCCCCCCCCS |
| InChI | InChI=1S/C19H38O2S/c1-18(17-20)19(21)15-13-11-9-7-5-3-2-4-6-8-10-12-14-16-22/h13,15,18-22H,2-12,14,16-17H2,1H3/b15-13+/t18-,19+/m0/s1 |
| InChIKey | RIOSDDGOVRUXFH-ZTIKBKQBSA-N |
| XLogP | 5.14 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.58 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|