C29H33AsFN6O9 — CID 88861301
CID 88861301 (PubChem CID 88861301) has the molecular formula C29H33AsFN6O9 and a molecular weight of 703.54 g/mol.
| Compound Name | CID 88861301 |
|---|---|
| PubChem CID | 88861301 |
| Molecular Formula | C29H33AsFN6O9 |
| Molecular Weight | 703.54 g/mol |
| Exact Mass | 703.15 |
| IUPAC Name | — |
| SMILES | O=C(O)C[C@H]([As]C(=O)c1cc(OCC(=O)N2CCC[C@H]2C(=O)NC2CC2)n(-c2cccc(F)c2)n1)C(=O)N1CCN(C(=O)O)CC1 |
| InChI | InChI=1S/C29H33AsFN6O9/c31-17-3-1-4-19(13-17)37-24(46-16-23(38)36-8-2-5-22(36)27(42)32-18-6-7-18)15-21(33-37)26(41)30-20(14-25(39)40)28(43)34-9-11-35(12-10-34)29(44)45/h1,3-4,13,15,18,20,22H,2,5-12,14,16H2,(H,32,42)(H,39,40)(H,44,45)/t20-,22-/m0/s1 |
| InChIKey | AIEYEFFFOCMEMM-UNMCSNQZSA-N |
| XLogP | 0.59 |
| TPSA | 191.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.54 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|