C19H27NO6 — CID 8886137
dimethyl 5-[2-[[(2R)-heptan-2-yl]amino]-2-oxoethoxy]benzene-1,3-dicarboxylate (PubChem CID 8886137) has the molecular formula C19H27NO6 and a molecular weight of 365.43 g/mol. Its IUPAC name is dimethyl 5-[2-[[(2R)-heptan-2-yl]amino]-2-oxoethoxy]benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-[2-[[(2R)-heptan-2-yl]amino]-2-oxoethoxy]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 8886137 |
| Molecular Formula | C19H27NO6 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.18 |
| IUPAC Name | dimethyl 5-[2-[[(2R)-heptan-2-yl]amino]-2-oxoethoxy]benzene-1,3-dicarboxylate |
| SMILES | CCCCC[C@@H](C)NC(=O)COc1cc(C(=O)OC)cc(C(=O)OC)c1 |
| InChI | InChI=1S/C19H27NO6/c1-5-6-7-8-13(2)20-17(21)12-26-16-10-14(18(22)24-3)9-15(11-16)19(23)25-4/h9-11,13H,5-8,12H2,1-4H3,(H,20,21)/t13-/m1/s1 |
| InChIKey | QINAEAMEUWUFKF-CYBMUJFWSA-N |
| XLogP | 2.72 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|