C38H60O4 — CID 88861472
[(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoyl] (Z,12R)-12-hydroxyoctadec-9-enoate (PubChem CID 88861472) has the molecular formula C38H60O4 and a molecular weight of 580.89 g/mol. Its IUPAC name is [(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoyl] (Z,12R)-12-hydroxyoctadec-9-enoate.
| Compound Name | [(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoyl] (Z,12R)-12-hydroxyoctadec-9-enoate |
|---|---|
| PubChem CID | 88861472 |
| Molecular Formula | C38H60O4 |
| Molecular Weight | 580.89 g/mol |
| Exact Mass | 580.45 |
| IUPAC Name | [(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoyl] (Z,12R)-12-hydroxyoctadec-9-enoate |
| SMILES | CCCCCC[C@@H](O)C/C=C\CCCCCCCC(=O)OC(=O)/C=C(C)/C=C/C=C(C)/C=C/C1=C(C)CCCC1(C)C |
| InChI | InChI=1S/C38H60O4/c1-7-8-9-16-24-34(39)25-17-14-12-10-11-13-15-18-26-36(40)42-37(41)30-32(3)22-19-21-31(2)27-28-35-33(4)23-20-29-38(35,5)6/h14,17,19,21-22,27-28,30,34,39H,7-13,15-16,18,20,23-26,29H2,1-6H3/b17-14-,22-19+,28-27+,31-21+,32-30+/t34-/m1/s1 |
| InChIKey | SPBNYSGEGIJBRF-QERZDHNISA-N |
| XLogP | 10.60 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.89 |
| LogP ≤ 5 | 10.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|