C21H32O3 — CID 88861548
(3R,5S,8R,9S,10S,13S,14S,16R,17R)-17-ethynyl-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthrene-3,16,17-triol (PubChem CID 88861548) has the molecular formula C21H32O3 and a molecular weight of 332.48 g/mol. Its IUPAC name is (3R,5S,8R,9S,10S,13S,14S,16R,17R)-17-ethynyl-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthrene-3,16,17-triol.
| Compound Name | (3R,5S,8R,9S,10S,13S,14S,16R,17R)-17-ethynyl-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthrene-3,16,17-triol |
|---|---|
| PubChem CID | 88861548 |
| Molecular Formula | C21H32O3 |
| Molecular Weight | 332.48 g/mol |
| Exact Mass | 332.24 |
| IUPAC Name | (3R,5S,8R,9S,10S,13S,14S,16R,17R)-17-ethynyl-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthrene-3,16,17-triol |
| SMILES | C#C[C@]1(O)[C@H](O)C[C@H]2[C@@H]3CC[C@H]4C[C@H](O)CC[C@]4(C)[C@H]3CC[C@@]21C |
| InChI | InChI=1S/C21H32O3/c1-4-21(24)18(23)12-17-15-6-5-13-11-14(22)7-9-19(13,2)16(15)8-10-20(17,21)3/h1,13-18,22-24H,5-12H2,2-3H3/t13-,14+,15+,16-,17-,18+,19-,20-,21-/m0/s1 |
| InChIKey | JZPIBNJWXHUXHF-NGVHUDCCSA-N |
| XLogP | 2.73 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.48 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|