About nona-1,8-diene-4,6-dione
nona-1,8-diene-4,6-dione (PubChem CID 88861984) has the molecular formula C9H12O2
and a molecular weight of 152.19 g/mol. Its IUPAC name is nona-1,8-diene-4,6-dione.
Molecular Properties
| Compound Name | nona-1,8-diene-4,6-dione |
| PubChem CID | 88861984 |
| Molecular Formula | C9H12O2 |
| Molecular Weight | 152.19 g/mol |
| Exact Mass | 152.08 |
| IUPAC Name | nona-1,8-diene-4,6-dione |
| SMILES | C=CCC(=O)CC(=O)CC=C |
| InChI | InChI=1S/C9H12O2/c1-3-5-8(10)7-9(11)6-4-2/h3-4H,1-2,5-7H2 |
| InChIKey | HTKFVMCRQHNABC-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.19 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze nona-1,8-diene-4,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of nona-1,8-diene-4,6-dione?
The IUPAC name of nona-1,8-diene-4,6-dione (CID 88861984) is nona-1,8-diene-4,6-dione.
What is the SMILES notation for nona-1,8-diene-4,6-dione?
The canonical SMILES for nona-1,8-diene-4,6-dione is C=CCC(=O)CC(=O)CC=C.
What is the InChIKey of nona-1,8-diene-4,6-dione?
The InChIKey is HTKFVMCRQHNABC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O2/c1-3-5-8(10)7-9(11)6-4-2/h3-4H,1-2,5-7H2.
What are the key properties of nona-1,8-diene-4,6-dione?
nona-1,8-diene-4,6-dione has a molecular weight of 152.19 g/mol, XLogP of 1.67, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for nona-1,8-diene-4,6-dione is sourced from PubChem (CID 88861984), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).