C13H17BrN2O — CID 88862534
N-[(2R,4S)-6-bromo-2-propyl-1,2,3,4-tetrahydroquinolin-4-yl]formamide (PubChem CID 88862534) has the molecular formula C13H17BrN2O and a molecular weight of 297.20 g/mol. Its IUPAC name is N-[(2R,4S)-6-bromo-2-propyl-1,2,3,4-tetrahydroquinolin-4-yl]formamide.
| Compound Name | N-[(2R,4S)-6-bromo-2-propyl-1,2,3,4-tetrahydroquinolin-4-yl]formamide |
|---|---|
| PubChem CID | 88862534 |
| Molecular Formula | C13H17BrN2O |
| Molecular Weight | 297.20 g/mol |
| Exact Mass | 296.05 |
| IUPAC Name | N-[(2R,4S)-6-bromo-2-propyl-1,2,3,4-tetrahydroquinolin-4-yl]formamide |
| SMILES | CCC[C@@H]1C[C@H](NC=O)c2cc(Br)ccc2N1 |
| InChI | InChI=1S/C13H17BrN2O/c1-2-3-10-7-13(15-8-17)11-6-9(14)4-5-12(11)16-10/h4-6,8,10,13,16H,2-3,7H2,1H3,(H,15,17)/t10-,13+/m1/s1 |
| InChIKey | JZPHQCJZXCZLIW-MFKMUULPSA-N |
| XLogP | 3.22 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.20 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|