C13H21NO3 — CID 88862683
octyl (Z)-2-cyano-3-hydroxybut-2-enoate (PubChem CID 88862683) has the molecular formula C13H21NO3 and a molecular weight of 239.31 g/mol. Its IUPAC name is octyl (Z)-2-cyano-3-hydroxybut-2-enoate.
| Compound Name | octyl (Z)-2-cyano-3-hydroxybut-2-enoate |
|---|---|
| PubChem CID | 88862683 |
| Molecular Formula | C13H21NO3 |
| Molecular Weight | 239.31 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | octyl (Z)-2-cyano-3-hydroxybut-2-enoate |
| SMILES | CCCCCCCCOC(=O)/C(C#N)=C(/C)O |
| InChI | InChI=1S/C13H21NO3/c1-3-4-5-6-7-8-9-17-13(16)12(10-14)11(2)15/h15H,3-9H2,1-2H3/b12-11- |
| InChIKey | NLRSTYWEOUWQDF-QXMHVHEDSA-N |
| XLogP | 3.25 |
| TPSA | 70.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.31 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|