C23H21N7O2 — CID 88862795
3-[7-[4-(diethylamino)-2-methylphenyl]imino-3-pyridin-2-ylpyrazolo[5,1-c][1,2,4]triazol-6-yl]oxypropa-1,2-dien-1-one (PubChem CID 88862795) has the molecular formula C23H21N7O2 and a molecular weight of 427.47 g/mol. Its IUPAC name is 3-[7-[4-(diethylamino)-2-methylphenyl]imino-3-pyridin-2-ylpyrazolo[5,1-c][1,2,4]triazol-6-yl]oxypropa-1,2-dien-1-one.
| Compound Name | 3-[7-[4-(diethylamino)-2-methylphenyl]imino-3-pyridin-2-ylpyrazolo[5,1-c][1,2,4]triazol-6-yl]oxypropa-1,2-dien-1-one |
|---|---|
| PubChem CID | 88862795 |
| Molecular Formula | C23H21N7O2 |
| Molecular Weight | 427.47 g/mol |
| Exact Mass | 427.18 |
| IUPAC Name | 3-[7-[4-(diethylamino)-2-methylphenyl]imino-3-pyridin-2-ylpyrazolo[5,1-c][1,2,4]triazol-6-yl]oxypropa-1,2-dien-1-one |
| SMILES | CCN(CC)c1ccc(/N=C2\C(OC=C=C=O)=Nn3c2nnc3-c2ccccn2)c(C)c1 |
| InChI | InChI=1S/C23H21N7O2/c1-4-29(5-2)17-10-11-18(16(3)15-17)25-20-22-27-26-21(19-9-6-7-12-24-19)30(22)28-23(20)32-14-8-13-31/h6-7,9-12,14-15H,4-5H2,1-3H3/b25-20- |
| InChIKey | BLUSHNNVIIPIOG-QQTULTPQSA-N |
| XLogP | 3.31 |
| TPSA | 97.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.47 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|