C23H24N8O — CID 88862823
N,N-diethyl-4-[[6-(1-isocyanatoethyl)-3-pyridin-2-ylpyrazolo[5,1-c][1,2,4]triazol-7-ylidene]amino]-3-methylaniline (PubChem CID 88862823) has the molecular formula C23H24N8O and a molecular weight of 428.50 g/mol. Its IUPAC name is N,N-diethyl-4-[[6-(1-isocyanatoethyl)-3-pyridin-2-ylpyrazolo[5,1-c][1,2,4]triazol-7-ylidene]amino]-3-methylaniline.
| Compound Name | N,N-diethyl-4-[[6-(1-isocyanatoethyl)-3-pyridin-2-ylpyrazolo[5,1-c][1,2,4]triazol-7-ylidene]amino]-3-methylaniline |
|---|---|
| PubChem CID | 88862823 |
| Molecular Formula | C23H24N8O |
| Molecular Weight | 428.50 g/mol |
| Exact Mass | 428.21 |
| IUPAC Name | N,N-diethyl-4-[[6-(1-isocyanatoethyl)-3-pyridin-2-ylpyrazolo[5,1-c][1,2,4]triazol-7-ylidene]amino]-3-methylaniline |
| SMILES | CCN(CC)c1ccc(/N=C2/C(C(C)N=C=O)=Nn3c2nnc3-c2ccccn2)c(C)c1 |
| InChI | InChI=1S/C23H24N8O/c1-5-30(6-2)17-10-11-18(15(3)13-17)26-21-20(16(4)25-14-32)29-31-22(27-28-23(21)31)19-9-7-8-12-24-19/h7-13,16H,5-6H2,1-4H3/b26-21- |
| InChIKey | LRUCEPSGTNINKM-QLYXXIJNSA-N |
| XLogP | 3.56 |
| TPSA | 100.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.50 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|