C13H21N — CID 88863263
(1E,3Z,5Z)-4-cyclohexylhepta-1,3,5-trien-1-amine (PubChem CID 88863263) has the molecular formula C13H21N and a molecular weight of 191.32 g/mol. Its IUPAC name is (1E,3Z,5Z)-4-cyclohexylhepta-1,3,5-trien-1-amine.
| Compound Name | (1E,3Z,5Z)-4-cyclohexylhepta-1,3,5-trien-1-amine |
|---|---|
| PubChem CID | 88863263 |
| Molecular Formula | C13H21N |
| Molecular Weight | 191.32 g/mol |
| Exact Mass | 191.17 |
| IUPAC Name | (1E,3Z,5Z)-4-cyclohexylhepta-1,3,5-trien-1-amine |
| SMILES | C/C=C\C(=C/C=C/N)C1CCCCC1 |
| InChI | InChI=1S/C13H21N/c1-2-7-12(10-6-11-14)13-8-4-3-5-9-13/h2,6-7,10-11,13H,3-5,8-9,14H2,1H3/b7-2-,11-6+,12-10+ |
| InChIKey | DUPXEUQVNRKICL-AVBZYJSFSA-N |
| XLogP | 3.54 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.32 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|