About N-[3,5-bis(trifluoromethyl)phenyl]-4-(hydroxymethyl)-2-oxo-1H-quinoline-3-carboxamide
N-[3,5-bis(trifluoromethyl)phenyl]-4-(hydroxymethyl)-2-oxo-1H-quinoline-3-carboxamide (PubChem CID 88863659) has the molecular formula C19H12F6N2O3
and a molecular weight of 430.30 g/mol. Its IUPAC name is N-[3,5-bis(trifluoromethyl)phenyl]-4-(hydroxymethyl)-2-oxo-1H-quinoline-3-carboxamide.
Molecular Properties
| Compound Name | N-[3,5-bis(trifluoromethyl)phenyl]-4-(hydroxymethyl)-2-oxo-1H-quinoline-3-carboxamide |
| PubChem CID | 88863659 |
| Molecular Formula | C19H12F6N2O3 |
| Molecular Weight | 430.30 g/mol |
| Exact Mass | 430.08 |
| IUPAC Name | N-[3,5-bis(trifluoromethyl)phenyl]-4-(hydroxymethyl)-2-oxo-1H-quinoline-3-carboxamide |
| SMILES | O=C(Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1)c1c(CO)c2ccccc2[nH]c1=O |
| InChI | InChI=1S/C19H12F6N2O3/c20-18(21,22)9-5-10(19(23,24)25)7-11(6-9)26-16(29)15-13(8-28)12-3-1-2-4-14(12)27-17(15)30/h1-7,28H,8H2,(H,26,29)(H,27,30) |
| InChIKey | PFTMJJBWCSMBRV-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 430.30 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[3,5-bis(trifluoromethyl)phenyl]-4-(hydroxymethyl)-2-oxo-1H-quinoline-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3,5-bis(trifluoromethyl)phenyl]-4-(hydroxymethyl)-2-oxo-1H-quinoline-3-carboxamide?
The IUPAC name of N-[3,5-bis(trifluoromethyl)phenyl]-4-(hydroxymethyl)-2-oxo-1H-quinoline-3-carboxamide (CID 88863659) is N-[3,5-bis(trifluoromethyl)phenyl]-4-(hydroxymethyl)-2-oxo-1H-quinoline-3-carboxamide.
What is the SMILES notation for N-[3,5-bis(trifluoromethyl)phenyl]-4-(hydroxymethyl)-2-oxo-1H-quinoline-3-carboxamide?
The canonical SMILES for N-[3,5-bis(trifluoromethyl)phenyl]-4-(hydroxymethyl)-2-oxo-1H-quinoline-3-carboxamide is O=C(Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1)c1c(CO)c2ccccc2[nH]c1=O.
What is the InChIKey of N-[3,5-bis(trifluoromethyl)phenyl]-4-(hydroxymethyl)-2-oxo-1H-quinoline-3-carboxamide?
The InChIKey is PFTMJJBWCSMBRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H12F6N2O3/c20-18(21,22)9-5-10(19(23,24)25)7-11(6-9)26-16(29)15-13(8-28)12-3-1-2-4-14(12)27-17(15)30/h1-7,28H,8H2,(H,26,29)(H,27,30).
What are the key properties of N-[3,5-bis(trifluoromethyl)phenyl]-4-(hydroxymethyl)-2-oxo-1H-quinoline-3-carboxamide?
N-[3,5-bis(trifluoromethyl)phenyl]-4-(hydroxymethyl)-2-oxo-1H-quinoline-3-carboxamide has a molecular weight of 430.30 g/mol, XLogP of 4.31, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3,5-bis(trifluoromethyl)phenyl]-4-(hydroxymethyl)-2-oxo-1H-quinoline-3-carboxamide is sourced from PubChem (CID 88863659), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).