C11H21NO — CID 88863692
(Z,2R)-3-ethenyl-1-(ethylamino)hept-5-en-2-ol (PubChem CID 88863692) has the molecular formula C11H21NO and a molecular weight of 183.29 g/mol. Its IUPAC name is (Z,2R)-3-ethenyl-1-(ethylamino)hept-5-en-2-ol.
| Compound Name | (Z,2R)-3-ethenyl-1-(ethylamino)hept-5-en-2-ol |
|---|---|
| PubChem CID | 88863692 |
| Molecular Formula | C11H21NO |
| Molecular Weight | 183.29 g/mol |
| Exact Mass | 183.16 |
| IUPAC Name | (Z,2R)-3-ethenyl-1-(ethylamino)hept-5-en-2-ol |
| SMILES | C=CC(C/C=C\C)[C@@H](O)CNCC |
| InChI | InChI=1S/C11H21NO/c1-4-7-8-10(5-2)11(13)9-12-6-3/h4-5,7,10-13H,2,6,8-9H2,1,3H3/b7-4-/t10?,11-/m0/s1 |
| InChIKey | NSOOFGNLVVBHJJ-DKKAXAFISA-N |
| XLogP | 1.73 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.29 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|