C12H19N3 — CID 88863715
(1Z,3Z,6E)-6-[[amino(methyl)amino]methylidene]-3-methyl-5-methylideneocta-1,3,7-trien-1-amine (PubChem CID 88863715) has the molecular formula C12H19N3 and a molecular weight of 205.30 g/mol. Its IUPAC name is (1Z,3Z,6E)-6-[[amino(methyl)amino]methylidene]-3-methyl-5-methylideneocta-1,3,7-trien-1-amine.
| Compound Name | (1Z,3Z,6E)-6-[[amino(methyl)amino]methylidene]-3-methyl-5-methylideneocta-1,3,7-trien-1-amine |
|---|---|
| PubChem CID | 88863715 |
| Molecular Formula | C12H19N3 |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.16 |
| IUPAC Name | (1Z,3Z,6E)-6-[[amino(methyl)amino]methylidene]-3-methyl-5-methylideneocta-1,3,7-trien-1-amine |
| SMILES | C=C/C(=C\N(C)N)C(=C)/C=C(C)\C=C/N |
| InChI | InChI=1S/C12H19N3/c1-5-12(9-15(4)14)11(3)8-10(2)6-7-13/h5-9H,1,3,13-14H2,2,4H3/b7-6-,10-8-,12-9+ |
| InChIKey | ROFJEPPBSSYMDN-MLMFGTCKSA-N |
| XLogP | 1.84 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|