C10H17N3O2S3 — CID 88863834
6-methylidene-1,3,5-tris(2-sulfanylethyl)-1,3,5-triazinane-2,4-dione (PubChem CID 88863834) has the molecular formula C10H17N3O2S3 and a molecular weight of 307.47 g/mol. Its IUPAC name is 6-methylidene-1,3,5-tris(2-sulfanylethyl)-1,3,5-triazinane-2,4-dione.
| Compound Name | 6-methylidene-1,3,5-tris(2-sulfanylethyl)-1,3,5-triazinane-2,4-dione |
|---|---|
| PubChem CID | 88863834 |
| Molecular Formula | C10H17N3O2S3 |
| Molecular Weight | 307.47 g/mol |
| Exact Mass | 307.05 |
| IUPAC Name | 6-methylidene-1,3,5-tris(2-sulfanylethyl)-1,3,5-triazinane-2,4-dione |
| SMILES | C=C1N(CCS)C(=O)N(CCS)C(=O)N1CCS |
| InChI | InChI=1S/C10H17N3O2S3/c1-8-11(2-5-16)9(14)13(4-7-18)10(15)12(8)3-6-17/h16-18H,1-7H2 |
| InChIKey | JYQUZCBREXJGEK-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 43.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.47 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|