C16H29N3O2S3 — CID 88863841
6-methylidene-1,3,5-tris(2-sulfanylbutyl)-1,3,5-triazinane-2,4-dione (PubChem CID 88863841) has the molecular formula C16H29N3O2S3 and a molecular weight of 391.63 g/mol. Its IUPAC name is 6-methylidene-1,3,5-tris(2-sulfanylbutyl)-1,3,5-triazinane-2,4-dione.
| Compound Name | 6-methylidene-1,3,5-tris(2-sulfanylbutyl)-1,3,5-triazinane-2,4-dione |
|---|---|
| PubChem CID | 88863841 |
| Molecular Formula | C16H29N3O2S3 |
| Molecular Weight | 391.63 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | 6-methylidene-1,3,5-tris(2-sulfanylbutyl)-1,3,5-triazinane-2,4-dione |
| SMILES | C=C1N(CC(S)CC)C(=O)N(CC(S)CC)C(=O)N1CC(S)CC |
| InChI | InChI=1S/C16H29N3O2S3/c1-5-12(22)8-17-11(4)18(9-13(23)6-2)16(21)19(15(17)20)10-14(24)7-3/h12-14,22-24H,4-10H2,1-3H3 |
| InChIKey | GMEGVNVGKLYASA-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 43.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.63 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|