C25H29N5O3S — CID 88863979
5-N-[(E)-1-[5-(2,3-dihydro-1H-inden-5-yl)-4-hydroxy-1-methylpyrazol-3-yl]ethylideneamino]-2-N,2-N-diethylthiophene-2,5-dicarboxamide (PubChem CID 88863979) has the molecular formula C25H29N5O3S and a molecular weight of 479.61 g/mol. Its IUPAC name is 5-N-[(E)-1-[5-(2,3-dihydro-1H-inden-5-yl)-4-hydroxy-1-methylpyrazol-3-yl]ethylideneamino]-2-N,2-N-diethylthiophene-2,5-dicarboxamide.
| Compound Name | 5-N-[(E)-1-[5-(2,3-dihydro-1H-inden-5-yl)-4-hydroxy-1-methylpyrazol-3-yl]ethylideneamino]-2-N,2-N-diethylthiophene-2,5-dicarboxamide |
|---|---|
| PubChem CID | 88863979 |
| Molecular Formula | C25H29N5O3S |
| Molecular Weight | 479.61 g/mol |
| Exact Mass | 479.20 |
| IUPAC Name | 5-N-[(E)-1-[5-(2,3-dihydro-1H-inden-5-yl)-4-hydroxy-1-methylpyrazol-3-yl]ethylideneamino]-2-N,2-N-diethylthiophene-2,5-dicarboxamide |
| SMILES | CCN(CC)C(=O)c1ccc(C(=O)N/N=C(\C)c2nn(C)c(-c3ccc4c(c3)CCC4)c2O)s1 |
| InChI | InChI=1S/C25H29N5O3S/c1-5-30(6-2)25(33)20-13-12-19(34-20)24(32)27-26-15(3)21-23(31)22(29(4)28-21)18-11-10-16-8-7-9-17(16)14-18/h10-14,31H,5-9H2,1-4H3,(H,27,32)/b26-15+ |
| InChIKey | DAMUCQUFLWJDGF-CVKSISIWSA-N |
| XLogP | 3.98 |
| TPSA | 99.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.61 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|