About N-[2-(trifluoromethyl)-1,3-dioxolan-2-yl]benzamide
N-[2-(trifluoromethyl)-1,3-dioxolan-2-yl]benzamide (PubChem CID 888641) has the molecular formula C11H10F3NO3
and a molecular weight of 261.20 g/mol. Its IUPAC name is N-[2-(trifluoromethyl)-1,3-dioxolan-2-yl]benzamide.
Molecular Properties
| Compound Name | N-[2-(trifluoromethyl)-1,3-dioxolan-2-yl]benzamide |
| PubChem CID | 888641 |
| Molecular Formula | C11H10F3NO3 |
| Molecular Weight | 261.20 g/mol |
| Exact Mass | 261.06 |
| IUPAC Name | N-[2-(trifluoromethyl)-1,3-dioxolan-2-yl]benzamide |
| SMILES | O=C(NC1(C(F)(F)F)OCCO1)c1ccccc1 |
| InChI | InChI=1S/C11H10F3NO3/c12-10(13,14)11(17-6-7-18-11)15-9(16)8-4-2-1-3-5-8/h1-5H,6-7H2,(H,15,16) |
| InChIKey | UATZREYEVARURI-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.20 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[2-(trifluoromethyl)-1,3-dioxolan-2-yl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(trifluoromethyl)-1,3-dioxolan-2-yl]benzamide?
The IUPAC name of N-[2-(trifluoromethyl)-1,3-dioxolan-2-yl]benzamide (CID 888641) is N-[2-(trifluoromethyl)-1,3-dioxolan-2-yl]benzamide.
What is the SMILES notation for N-[2-(trifluoromethyl)-1,3-dioxolan-2-yl]benzamide?
The canonical SMILES for N-[2-(trifluoromethyl)-1,3-dioxolan-2-yl]benzamide is O=C(NC1(C(F)(F)F)OCCO1)c1ccccc1.
What is the InChIKey of N-[2-(trifluoromethyl)-1,3-dioxolan-2-yl]benzamide?
The InChIKey is UATZREYEVARURI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10F3NO3/c12-10(13,14)11(17-6-7-18-11)15-9(16)8-4-2-1-3-5-8/h1-5H,6-7H2,(H,15,16).
What are the key properties of N-[2-(trifluoromethyl)-1,3-dioxolan-2-yl]benzamide?
N-[2-(trifluoromethyl)-1,3-dioxolan-2-yl]benzamide has a molecular weight of 261.20 g/mol, XLogP of 1.68, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(trifluoromethyl)-1,3-dioxolan-2-yl]benzamide is sourced from PubChem (CID 888641), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).