C21H25N9O — CID 88864102
7-[4-(diethylamino)-2-methylphenyl]imino-N-methoxy-N-methyl-3-pyrazin-2-ylpyrazolo[5,1-c][1,2,4]triazol-6-amine (PubChem CID 88864102) has the molecular formula C21H25N9O and a molecular weight of 419.49 g/mol. Its IUPAC name is 7-[4-(diethylamino)-2-methylphenyl]imino-N-methoxy-N-methyl-3-pyrazin-2-ylpyrazolo[5,1-c][1,2,4]triazol-6-amine.
| Compound Name | 7-[4-(diethylamino)-2-methylphenyl]imino-N-methoxy-N-methyl-3-pyrazin-2-ylpyrazolo[5,1-c][1,2,4]triazol-6-amine |
|---|---|
| PubChem CID | 88864102 |
| Molecular Formula | C21H25N9O |
| Molecular Weight | 419.49 g/mol |
| Exact Mass | 419.22 |
| IUPAC Name | 7-[4-(diethylamino)-2-methylphenyl]imino-N-methoxy-N-methyl-3-pyrazin-2-ylpyrazolo[5,1-c][1,2,4]triazol-6-amine |
| SMILES | CCN(CC)c1ccc(/N=C2/C(N(C)OC)=Nn3c2nnc3-c2cnccn2)c(C)c1 |
| InChI | InChI=1S/C21H25N9O/c1-6-29(7-2)15-8-9-16(14(3)12-15)24-18-20-26-25-19(17-13-22-10-11-23-17)30(20)27-21(18)28(4)31-5/h8-13H,6-7H2,1-5H3/b24-18+ |
| InChIKey | ZTQHAUUHZSWEPP-HKOYGPOVSA-N |
| XLogP | 2.68 |
| TPSA | 96.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.49 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|