About 2-[[4-(1-cyano-5,5,5-trifluoropentyl)cyclohexylidene]amino]oxyacetic acid
2-[[4-(1-cyano-5,5,5-trifluoropentyl)cyclohexylidene]amino]oxyacetic acid (PubChem CID 88864349) has the molecular formula C14H19F3N2O3
and a molecular weight of 320.31 g/mol. Its IUPAC name is 2-[[4-(1-cyano-5,5,5-trifluoropentyl)cyclohexylidene]amino]oxyacetic acid.
Molecular Properties
| Compound Name | 2-[[4-(1-cyano-5,5,5-trifluoropentyl)cyclohexylidene]amino]oxyacetic acid |
| PubChem CID | 88864349 |
| Molecular Formula | C14H19F3N2O3 |
| Molecular Weight | 320.31 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | 2-[[4-(1-cyano-5,5,5-trifluoropentyl)cyclohexylidene]amino]oxyacetic acid |
| SMILES | N#CC(CCCC(F)(F)F)C1CCC(=NOCC(=O)O)CC1 |
| InChI | InChI=1S/C14H19F3N2O3/c15-14(16,17)7-1-2-11(8-18)10-3-5-12(6-4-10)19-22-9-13(20)21/h10-11H,1-7,9H2,(H,20,21)/b19-12- |
| InChIKey | DJPKVLGDOQAOQT-UNOMPAQXSA-N |
| XLogP | 3.51 |
| TPSA | 82.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.31 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[[4-(1-cyano-5,5,5-trifluoropentyl)cyclohexylidene]amino]oxyacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[4-(1-cyano-5,5,5-trifluoropentyl)cyclohexylidene]amino]oxyacetic acid?
The IUPAC name of 2-[[4-(1-cyano-5,5,5-trifluoropentyl)cyclohexylidene]amino]oxyacetic acid (CID 88864349) is 2-[[4-(1-cyano-5,5,5-trifluoropentyl)cyclohexylidene]amino]oxyacetic acid.
What is the SMILES notation for 2-[[4-(1-cyano-5,5,5-trifluoropentyl)cyclohexylidene]amino]oxyacetic acid?
The canonical SMILES for 2-[[4-(1-cyano-5,5,5-trifluoropentyl)cyclohexylidene]amino]oxyacetic acid is N#CC(CCCC(F)(F)F)C1CCC(=NOCC(=O)O)CC1.
What is the InChIKey of 2-[[4-(1-cyano-5,5,5-trifluoropentyl)cyclohexylidene]amino]oxyacetic acid?
The InChIKey is DJPKVLGDOQAOQT-UNOMPAQXSA-N. The full InChI is InChI=1S/C14H19F3N2O3/c15-14(16,17)7-1-2-11(8-18)10-3-5-12(6-4-10)19-22-9-13(20)21/h10-11H,1-7,9H2,(H,20,21)/b19-12-.
What are the key properties of 2-[[4-(1-cyano-5,5,5-trifluoropentyl)cyclohexylidene]amino]oxyacetic acid?
2-[[4-(1-cyano-5,5,5-trifluoropentyl)cyclohexylidene]amino]oxyacetic acid has a molecular weight of 320.31 g/mol, XLogP of 3.51, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[4-(1-cyano-5,5,5-trifluoropentyl)cyclohexylidene]amino]oxyacetic acid is sourced from PubChem (CID 88864349), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).