C38H20F6N8O2 — CID 88864519
2-[7-methyl-4-(trifluoromethyl)-1,10-phenanthrolin-2-yl]-5-[3-[5-[7-methyl-4-(trifluoromethyl)-1,10-phenanthrolin-2-yl]-1,3,4-oxadiazol-2-yl]phenyl]-1,3,4-oxadiazole (PubChem CID 88864519) has the molecular formula C38H20F6N8O2 and a molecular weight of 734.62 g/mol. Its IUPAC name is 2-[7-methyl-4-(trifluoromethyl)-1,10-phenanthrolin-2-yl]-5-[3-[5-[7-methyl-4-(trifluoromethyl)-1,10-phenanthrolin-2-yl]-1,3,4-oxadiazol-2-yl]phenyl]-1,3,4-oxadiazole.
| Compound Name | 2-[7-methyl-4-(trifluoromethyl)-1,10-phenanthrolin-2-yl]-5-[3-[5-[7-methyl-4-(trifluoromethyl)-1,10-phenanthrolin-2-yl]-1,3,4-oxadiazol-2-yl]phenyl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 88864519 |
| Molecular Formula | C38H20F6N8O2 |
| Molecular Weight | 734.62 g/mol |
| Exact Mass | 734.16 |
| IUPAC Name | 2-[7-methyl-4-(trifluoromethyl)-1,10-phenanthrolin-2-yl]-5-[3-[5-[7-methyl-4-(trifluoromethyl)-1,10-phenanthrolin-2-yl]-1,3,4-oxadiazol-2-yl]phenyl]-1,3,4-oxadiazole |
| SMILES | Cc1ccnc2c1ccc1c(C(F)(F)F)cc(-c3nnc(-c4cccc(-c5nnc(-c6cc(C(F)(F)F)c7ccc8c(C)ccnc8c7n6)o5)c4)o3)nc12 |
| InChI | InChI=1S/C38H20F6N8O2/c1-17-10-12-45-29-21(17)6-8-23-25(37(39,40)41)15-27(47-31(23)29)35-51-49-33(53-35)19-4-3-5-20(14-19)34-50-52-36(54-34)28-16-26(38(42,43)44)24-9-7-22-18(2)11-13-46-30(22)32(24)48-28/h3-16H,1-2H3 |
| InChIKey | ZNCRTFQZBCWZFY-UHFFFAOYSA-N |
| XLogP | 9.97 |
| TPSA | 129.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.62 |
| LogP ≤ 5 | 9.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|