C18H27ClN4O4 — CID 88864673
(3S)-3-[(2R)-4-(5-chloro-2-pyridinyl)-2-methylpiperazine-1-carbonyl]-N,2-dihydroxy-5-methylhexanamide (PubChem CID 88864673) has the molecular formula C18H27ClN4O4 and a molecular weight of 398.89 g/mol. Its IUPAC name is (3S)-3-[(2R)-4-(5-chloro-2-pyridinyl)-2-methylpiperazine-1-carbonyl]-N,2-dihydroxy-5-methylhexanamide.
| Compound Name | (3S)-3-[(2R)-4-(5-chloro-2-pyridinyl)-2-methylpiperazine-1-carbonyl]-N,2-dihydroxy-5-methylhexanamide |
|---|---|
| PubChem CID | 88864673 |
| Molecular Formula | C18H27ClN4O4 |
| Molecular Weight | 398.89 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | (3S)-3-[(2R)-4-(5-chloro-2-pyridinyl)-2-methylpiperazine-1-carbonyl]-N,2-dihydroxy-5-methylhexanamide |
| SMILES | CC(C)C[C@H](C(=O)N1CCN(c2ccc(Cl)cn2)C[C@H]1C)C(O)C(=O)NO |
| InChI | InChI=1S/C18H27ClN4O4/c1-11(2)8-14(16(24)17(25)21-27)18(26)23-7-6-22(10-12(23)3)15-5-4-13(19)9-20-15/h4-5,9,11-12,14,16,24,27H,6-8,10H2,1-3H3,(H,21,25)/t12-,14+,16?/m1/s1 |
| InChIKey | XKDZQWIGQUPITR-SCYXSXAHSA-N |
| XLogP | 1.30 |
| TPSA | 106.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.89 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|