C20H16FN7O2S — CID 88864757
4-[(1R)-1-[[4-(5-fluoro-1H-pyrrolo[2,3-b]pyridin-3-yl)-5-isocyanopyrimidin-2-yl]amino]ethyl]benzenesulfonamide (PubChem CID 88864757) has the molecular formula C20H16FN7O2S and a molecular weight of 437.46 g/mol. Its IUPAC name is 4-[(1R)-1-[[4-(5-fluoro-1H-pyrrolo[2,3-b]pyridin-3-yl)-5-isocyanopyrimidin-2-yl]amino]ethyl]benzenesulfonamide.
| Compound Name | 4-[(1R)-1-[[4-(5-fluoro-1H-pyrrolo[2,3-b]pyridin-3-yl)-5-isocyanopyrimidin-2-yl]amino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 88864757 |
| Molecular Formula | C20H16FN7O2S |
| Molecular Weight | 437.46 g/mol |
| Exact Mass | 437.11 |
| IUPAC Name | 4-[(1R)-1-[[4-(5-fluoro-1H-pyrrolo[2,3-b]pyridin-3-yl)-5-isocyanopyrimidin-2-yl]amino]ethyl]benzenesulfonamide |
| SMILES | [C-]#[N+]c1cnc(N[C@H](C)c2ccc(S(N)(=O)=O)cc2)nc1-c1c[nH]c2ncc(F)cc12 |
| InChI | InChI=1S/C20H16FN7O2S/c1-11(12-3-5-14(6-4-12)31(22,29)30)27-20-26-10-17(23-2)18(28-20)16-9-25-19-15(16)7-13(21)8-24-19/h3-11H,1H3,(H,24,25)(H2,22,29,30)(H,26,27,28)/t11-/m1/s1 |
| InChIKey | MRFLFTLNVAWPHE-LLVKDONJSA-N |
| XLogP | 3.53 |
| TPSA | 131.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.46 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|